Alprazolam
| Alprazolam | |
|---|---|
| |
| Molecular structure via molpic | |
| Molecular formula | C17H13ClN4 |
| Molecular mass | 308.8 g/mol |
| Appearance | Crystals from ethyl acetate |
| Melting point | 228-229.5 °C |
| Decomposition | When heated to decomposition it emits toxic fumes of /hydrogen chloride/ and /nitric oxides/. |
| Solubility | Insoluble in water |
| Chirality | achiral |
| Identifiers [] | |
|---|---|
| IUPAC name | 8-chloro-1-methyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| Cannonical SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4 |
| InChI | InChI=1S/C17H13ClN4/c1-11-20-21-16-10-19-17(12-5-3-2-4-6-12)14-9-13(18)7-8-15(14)22(11)16/h2-9H,10H2,1H3 |
| InChIKey | VREFGVBLTWBCJP-UHFFFAOYSA-N |
| Dosing |
|---|
| Insufflated [] | |
|---|---|
| Threshold | 0.25 - 0.6875 mg |
| Light | 0.6875 - 1 mg |
| Common | 1 - 1.5 mg |
| Strong | 1.5 - 2 mg |
| Heavy | 2 - 3 mg |
| Oral [] | |
|---|---|
| Threshold | 0.125 - 0.5 mg |
| Light | 0.5 - 1 mg |
| Common | 1 - 1.5 mg |
| Strong | 1.5 - 2 mg |
| Heavy | 2 - 4 mg |
| Statistically derived dosages by Sernyl |
Alprazolam (also known as Xanax, Niravam, Trankimazin, Tranquinal, Alplax, Constan, Frontal, Solanax, Tafil or Xanor) is a depressant substance of the amine class.
Chemistry
Alprazolam is typically prepared in the form of its amine salts dihydrate.
Alprazolam is a achiral mixture