2C-E | |
---|---|
| |
Molecular structure via molpic | |
Molecular formula | C12H19NO2 |
Molecular mass | 209.28 g/mol |
Predicted LogP | 2.4 |
Identifiers [] | |
---|---|
IUPAC name | 2-(4-ethyl-2,5-dimethoxyphenyl)ethanamine |
Cannonical SMILES | CCC1=CC(=C(C=C1OC)CCN)OC |
InChI | InChI=1S/C12H19NO2/c1-4-9-7-12(15-3)10(5-6-13)8-11(9)14-2/h7-8H,4-6,13H2,1-3H3 |
InChIKey | VDRGNAMREYBIHA-UHFFFAOYSA-N |
2,5-Dimethoxy-4-ethylphenethylamine
2,5-Dimethoxy-4-Ethylphenethylamine (also known as 2C-E, Eternity [Street Name], Aqua Rust [Street Name], Hummingbird [Street Name], DEA No. 7509, 4-ETHYL-2,5-DIMETHOXY-.BETA.-PHENETHYLAMINE, 2,5-Dimethoxy-4-ethyl phenethylamine, Benzeneethanamine, 4-ethyl-2,5-dimethoxy-, VDRGNAMREYBIHA-UHFFFAOYSA-N or BDBM50240788) is a substance of the 2,5-dimethoxyphenethylamine class.
See also
External links
- 2,5-Dimethoxy-4-ethylphenethylamine (Wikipedia)
- 2,5-Dimethoxy-4-ethylphenethylamine (Wikidata)
- 2,5-Dimethoxy-4-ethylphenethylamine (PubChem)
- 2,5-Dimethoxy-4-ethylphenethylamine (ChemSpider)
- 2,5-Dimethoxy-4-ethylphenethylamine (ChEMBL)
- 2,5-Dimethoxy-4-ethylphenethylamine (Probes & Drugs)
- 2,5-Dimethoxy-4-ethylphenethylamine (Common Chemistry)
- 2,5-Dimethoxy-4-ethylphenethylamine (HMDB)
- 2,5-Dimethoxy-4-ethylphenethylamine (UNII)
- 2,5-Dimethoxy-4-ethylphenethylamine (EPA DSSTox)